C20H41NO6 — CID 90877716
butan-2-ol;butan-2-yl acetate;2-(butan-2-yloxyamino)ethyl 2-methylprop-2-enoate (PubChem CID 90877716) has the molecular formula C20H41NO6 and a molecular weight of 391.55 g/mol. Its IUPAC name is butan-2-ol;butan-2-yl acetate;2-(butan-2-yloxyamino)ethyl 2-methylprop-2-enoate.
| Compound Name | butan-2-ol;butan-2-yl acetate;2-(butan-2-yloxyamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90877716 |
| Molecular Formula | C20H41NO6 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | butan-2-ol;butan-2-yl acetate;2-(butan-2-yloxyamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNOC(C)CC.CCC(C)O.CCC(C)OC(C)=O |
| InChI | InChI=1S/C10H19NO3.C6H12O2.C4H10O/c1-5-9(4)14-11-6-7-13-10(12)8(2)3;1-4-5(2)8-6(3)7;1-3-4(2)5/h9,11H,2,5-7H2,1,3-4H3;5H,4H2,1-3H3;4-5H,3H2,1-2H3 |
| InChIKey | MAPWVWTZEXNXMZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|