C28H46O11 — CID 131747480
dibutan-2-yl (E)-but-2-enedioate;dipropan-2-yl (E)-but-2-enedioate;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 131747480) has the molecular formula C28H46O11 and a molecular weight of 558.67 g/mol. Its IUPAC name is dibutan-2-yl (E)-but-2-enedioate;dipropan-2-yl (E)-but-2-enedioate;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | dibutan-2-yl (E)-but-2-enedioate;dipropan-2-yl (E)-but-2-enedioate;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 131747480 |
| Molecular Formula | C28H46O11 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | dibutan-2-yl (E)-but-2-enedioate;dipropan-2-yl (E)-but-2-enedioate;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.CC(C)OC(=O)/C=C/C(=O)OC(C)C.CCC(C)OC(=O)/C=C/C(=O)OC(C)CC |
| InChI | InChI=1S/C12H20O4.C10H16O4.C6H10O3/c1-5-9(3)15-11(13)7-8-12(14)16-10(4)6-2;1-7(2)13-9(11)5-6-10(12)14-8(3)4;1-5(2)6(8)9-4-3-7/h7-10H,5-6H2,1-4H3;5-8H,1-4H3;7H,1,3-4H2,2H3/b8-7+;6-5+; |
| InChIKey | ALLUTGDGTXPMHI-LUTKJZFRSA-N |
| XLogP | 3.77 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|