C31H39FN6O2Si — CID 90907158
3-[(4-fluorophenyl)methyl]-7-methyl-5-[(1-methyltetrazol-5-yl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol (PubChem CID 90907158) has the molecular formula C31H39FN6O2Si and a molecular weight of 574.78 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-methyl-5-[(1-methyltetrazol-5-yl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-[(1-methyltetrazol-5-yl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
|---|---|
| PubChem CID | 90907158 |
| Molecular Formula | C31H39FN6O2Si |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-[(1-methyltetrazol-5-yl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
| SMILES | CC(C)[Si](Oc1c2ncc(Cc3ccc(F)cc3)cc2c(Cc2nnnn2C)c2cn(C)c(O)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H39FN6O2Si/c1-18(2)41(19(3)4,20(5)6)40-30-28-26(17-37(7)31(28)39)24(15-27-34-35-36-38(27)8)25-14-22(16-33-29(25)30)13-21-9-11-23(32)12-10-21/h9-12,14,16-20,39H,13,15H2,1-8H3 |
| InChIKey | OQTWWPSVVACMKQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|