C18H36NO2+ — CID 909088
1-methyl-1-[[(2S,4R)-2-[(2R)-2,4,4-trimethylpentyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium (PubChem CID 909088) has the molecular formula C18H36NO2+ and a molecular weight of 298.49 g/mol. Its IUPAC name is 1-methyl-1-[[(2S,4R)-2-[(2R)-2,4,4-trimethylpentyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium.
| Compound Name | 1-methyl-1-[[(2S,4R)-2-[(2R)-2,4,4-trimethylpentyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 909088 |
| Molecular Formula | C18H36NO2+ |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1-methyl-1-[[(2S,4R)-2-[(2R)-2,4,4-trimethylpentyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
| SMILES | C[C@@H](C[C@H]1OC[C@@H](C[N+]2(C)CCCCC2)O1)CC(C)(C)C |
| InChI | InChI=1S/C18H36NO2/c1-15(12-18(2,3)4)11-17-20-14-16(21-17)13-19(5)9-7-6-8-10-19/h15-17H,6-14H2,1-5H3/q+1/t15-,16+,17-/m0/s1 |
| InChIKey | NBLWOKORNFBCIG-BBWFWOEESA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|