C17H9N5O3 — CID 90915882
2-(5-nitrofuran-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 90915882) has the molecular formula C17H9N5O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-(5-nitrofuran-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-(5-nitrofuran-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 90915882 |
| Molecular Formula | C17H9N5O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-(5-nitrofuran-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)o1 |
| InChI | InChI=1S/C17H9N5O3/c23-22(24)12-6-5-11(25-12)17-20-15-9-3-1-7-18-13(9)14-10(16(15)21-17)4-2-8-19-14/h1-8H,(H,20,21) |
| InChIKey | RJEAUANTEVMWDX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|