C15H9BrN4 — CID 175295426
2-[(E)-2-bromoethenyl]-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 175295426) has the molecular formula C15H9BrN4 and a molecular weight of 325.17 g/mol. Its IUPAC name is 2-[(E)-2-bromoethenyl]-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-[(E)-2-bromoethenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 175295426 |
| Molecular Formula | C15H9BrN4 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 2-[(E)-2-bromoethenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | Br/C=C/c1nc2c3cccnc3c3ncccc3c2[nH]1 |
| InChI | InChI=1S/C15H9BrN4/c16-6-5-11-19-14-9-3-1-7-17-12(9)13-10(15(14)20-11)4-2-8-18-13/h1-8H,(H,19,20)/b6-5+ |
| InChIKey | ADHDTPMADJSFPJ-AATRIKPKSA-N |
| XLogP | 4.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|