C25H16N2O7 — CID 90919233
5-[(6,11-dihydroxynaphtho[2,3-b]indolizine-12-carbonyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 90919233) has the molecular formula C25H16N2O7 and a molecular weight of 456.41 g/mol. Its IUPAC name is 5-[(6,11-dihydroxynaphtho[2,3-b]indolizine-12-carbonyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(6,11-dihydroxynaphtho[2,3-b]indolizine-12-carbonyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 90919233 |
| Molecular Formula | C25H16N2O7 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 5-[(6,11-dihydroxynaphtho[2,3-b]indolizine-12-carbonyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2c3c(O)c4ccccc4c(O)c3n3ccccc23)cc(C(=O)O)c1 |
| InChI | InChI=1S/C25H16N2O7/c28-21-15-5-1-2-6-16(15)22(29)20-19(21)18(17-7-3-4-8-27(17)20)23(30)26-14-10-12(24(31)32)9-13(11-14)25(33)34/h1-11,28-29H,(H,26,30)(H,31,32)(H,33,34) |
| InChIKey | IUNHEYYHYCLRHZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|