C37H36N2OS2Si+2 — CID 90919245
3-methoxy-8-methyl-2H-1,3-benzothiazin-3-ium;(8-methyl-2H-1,3-benzothiazin-3-ium-3-yl)-triphenylsilane (PubChem CID 90919245) has the molecular formula C37H36N2OS2Si+2 and a molecular weight of 616.93 g/mol. Its IUPAC name is 3-methoxy-8-methyl-2H-1,3-benzothiazin-3-ium;(8-methyl-2H-1,3-benzothiazin-3-ium-3-yl)-triphenylsilane.
| Compound Name | 3-methoxy-8-methyl-2H-1,3-benzothiazin-3-ium;(8-methyl-2H-1,3-benzothiazin-3-ium-3-yl)-triphenylsilane |
|---|---|
| PubChem CID | 90919245 |
| Molecular Formula | C37H36N2OS2Si+2 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 3-methoxy-8-methyl-2H-1,3-benzothiazin-3-ium;(8-methyl-2H-1,3-benzothiazin-3-ium-3-yl)-triphenylsilane |
| SMILES | CO[N+]1=Cc2cccc(C)c2SC1.Cc1cccc2c1SC[N+]([Si](c1ccccc1)(c1ccccc1)c1ccccc1)=C2 |
| InChI | InChI=1S/C27H24NSSi.C10H12NOS/c1-22-12-11-13-23-20-28(21-29-27(22)23)30(24-14-5-2-6-15-24,25-16-7-3-8-17-25)26-18-9-4-10-19-26;1-8-4-3-5-9-6-11(12-2)7-13-10(8)9/h2-20H,21H2,1H3;3-6H,7H2,1-2H3/q2*+1 |
| InChIKey | VNBKDLXPALPXAH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 15.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|