C10H8FIN4O2 — CID 90919593
(4R)-4-(azidomethyl)-3-(3-fluoro-4-iodophenyl)-1,3-oxazolidin-2-one (PubChem CID 90919593) has the molecular formula C10H8FIN4O2 and a molecular weight of 362.10 g/mol. Its IUPAC name is (4R)-4-(azidomethyl)-3-(3-fluoro-4-iodophenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(azidomethyl)-3-(3-fluoro-4-iodophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90919593 |
| Molecular Formula | C10H8FIN4O2 |
| Molecular Weight | 362.10 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | (4R)-4-(azidomethyl)-3-(3-fluoro-4-iodophenyl)-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@@H]1COC(=O)N1c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C10H8FIN4O2/c11-8-3-6(1-2-9(8)12)16-7(4-14-15-13)5-18-10(16)17/h1-3,7H,4-5H2/t7-/m1/s1 |
| InChIKey | MRTBHNRHIPHVBV-SSDOTTSWSA-N |
| XLogP | 3.07 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.10 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|