C19H21FN6O2 — CID 91259488
2-[(1S,5R)-3-[4-[(4R)-4-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-2-methylpropanenitrile (PubChem CID 91259488) has the molecular formula C19H21FN6O2 and a molecular weight of 384.42 g/mol. Its IUPAC name is 2-[(1S,5R)-3-[4-[(4R)-4-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-2-methylpropanenitrile.
| Compound Name | 2-[(1S,5R)-3-[4-[(4R)-4-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 91259488 |
| Molecular Formula | C19H21FN6O2 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[(1S,5R)-3-[4-[(4R)-4-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)C1[C@H]2CN(c3ccc(N4C(=O)OC[C@H]4CN=[N+]=[N-])cc3F)C[C@@H]12 |
| InChI | InChI=1S/C19H21FN6O2/c1-19(2,10-21)17-13-7-25(8-14(13)17)16-4-3-11(5-15(16)20)26-12(6-23-24-22)9-28-18(26)27/h3-5,12-14,17H,6-9H2,1-2H3/t12-,13-,14+,17?/m1/s1 |
| InChIKey | HRXVYMWMRZEIGO-CXLVCKKSSA-N |
| XLogP | 3.69 |
| TPSA | 105.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|