C25H40N2O2 — CID 90920872
3-(6-aminohex-2-en-2-yl)-10,13-dimethyl-6-nitroso-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 90920872) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 3-(6-aminohex-2-en-2-yl)-10,13-dimethyl-6-nitroso-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-(6-aminohex-2-en-2-yl)-10,13-dimethyl-6-nitroso-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 90920872 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 3-(6-aminohex-2-en-2-yl)-10,13-dimethyl-6-nitroso-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC(=CCCCN)C1CCC2(C)C(C1)C(N=O)CC1C3CCC(=O)C3(C)CCC12 |
| InChI | InChI=1S/C25H40N2O2/c1-16(6-4-5-13-26)17-9-11-24(2)20-10-12-25(3)19(7-8-23(25)28)18(20)15-22(27-29)21(24)14-17/h6,17-22H,4-5,7-15,26H2,1-3H3 |
| InChIKey | IERFERPMTOQMDR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|