C19H25ClF3N3O3 — CID 90931697
2-acetamido-N-(1-chloro-1-phenylpropan-2-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 90931697) has the molecular formula C19H25ClF3N3O3 and a molecular weight of 435.87 g/mol. Its IUPAC name is 2-acetamido-N-(1-chloro-1-phenylpropan-2-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | 2-acetamido-N-(1-chloro-1-phenylpropan-2-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 90931697 |
| Molecular Formula | C19H25ClF3N3O3 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-acetamido-N-(1-chloro-1-phenylpropan-2-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | CC(=O)NC(CCCCNC(=O)C(F)(F)F)C(=O)NC(C)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C19H25ClF3N3O3/c1-12(16(20)14-8-4-3-5-9-14)25-17(28)15(26-13(2)27)10-6-7-11-24-18(29)19(21,22)23/h3-5,8-9,12,15-16H,6-7,10-11H2,1-2H3,(H,24,29)(H,25,28)(H,26,27) |
| InChIKey | DASZNORQRLPZQQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|