C17H14N4O4 — CID 90937985
methyl 4-(9-benzylpurin-8-yl)-2,4-dioxobutanoate (PubChem CID 90937985) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is methyl 4-(9-benzylpurin-8-yl)-2,4-dioxobutanoate.
| Compound Name | methyl 4-(9-benzylpurin-8-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 90937985 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl 4-(9-benzylpurin-8-yl)-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1nc2cncnc2n1Cc1ccccc1 |
| InChI | InChI=1S/C17H14N4O4/c1-25-17(24)14(23)7-13(22)16-20-12-8-18-10-19-15(12)21(16)9-11-5-3-2-4-6-11/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | QQDSKRHIMAHFQG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|