C17H17Br2ClN2O3 — CID 90952121
1-[(3,5-dibromo-4-methylphenyl)methyl]-7-nitro-1,2,3,4-tetrahydroisoquinolin-6-ol;hydrochloride (PubChem CID 90952121) has the molecular formula C17H17Br2ClN2O3 and a molecular weight of 492.60 g/mol. Its IUPAC name is 1-[(3,5-dibromo-4-methylphenyl)methyl]-7-nitro-1,2,3,4-tetrahydroisoquinolin-6-ol;hydrochloride.
| Compound Name | 1-[(3,5-dibromo-4-methylphenyl)methyl]-7-nitro-1,2,3,4-tetrahydroisoquinolin-6-ol;hydrochloride |
|---|---|
| PubChem CID | 90952121 |
| Molecular Formula | C17H17Br2ClN2O3 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 489.93 |
| IUPAC Name | 1-[(3,5-dibromo-4-methylphenyl)methyl]-7-nitro-1,2,3,4-tetrahydroisoquinolin-6-ol;hydrochloride |
| SMILES | Cc1c(Br)cc(CC2NCCc3cc(O)c([N+](=O)[O-])cc32)cc1Br.Cl |
| InChI | InChI=1S/C17H16Br2N2O3.ClH/c1-9-13(18)4-10(5-14(9)19)6-15-12-8-16(21(23)24)17(22)7-11(12)2-3-20-15;/h4-5,7-8,15,20,22H,2-3,6H2,1H3;1H |
| InChIKey | LZCCQLNXPSMRPS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|