C20H20Br2N2O6 — CID 91396980
1-[(3,5-dibromo-4-methylphenyl)methyl]-6-methyl-7-nitro-1,2,3,4-tetrahydroisoquinoline;oxalic acid (PubChem CID 91396980) has the molecular formula C20H20Br2N2O6 and a molecular weight of 544.20 g/mol. Its IUPAC name is 1-[(3,5-dibromo-4-methylphenyl)methyl]-6-methyl-7-nitro-1,2,3,4-tetrahydroisoquinoline;oxalic acid.
| Compound Name | 1-[(3,5-dibromo-4-methylphenyl)methyl]-6-methyl-7-nitro-1,2,3,4-tetrahydroisoquinoline;oxalic acid |
|---|---|
| PubChem CID | 91396980 |
| Molecular Formula | C20H20Br2N2O6 |
| Molecular Weight | 544.20 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 1-[(3,5-dibromo-4-methylphenyl)methyl]-6-methyl-7-nitro-1,2,3,4-tetrahydroisoquinoline;oxalic acid |
| SMILES | Cc1cc2c(cc1[N+](=O)[O-])C(Cc1cc(Br)c(C)c(Br)c1)NCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H18Br2N2O2.C2H2O4/c1-10-5-13-3-4-21-17(14(13)9-18(10)22(23)24)8-12-6-15(19)11(2)16(20)7-12;3-1(4)2(5)6/h5-7,9,17,21H,3-4,8H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | JNJKCZGMGXWBIT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|