C27H32ClFN5O5+ — CID 90956292
[1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxypiperidin-1-ium-1-yl]-morpholin-4-ylmethanone (PubChem CID 90956292) has the molecular formula C27H32ClFN5O5+ and a molecular weight of 561.03 g/mol. Its IUPAC name is [1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxypiperidin-1-ium-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxypiperidin-1-ium-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 90956292 |
| Molecular Formula | C27H32ClFN5O5+ |
| Molecular Weight | 561.03 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | [1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxypiperidin-1-ium-1-yl]-morpholin-4-ylmethanone |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1O[N+]1(C(=O)N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C27H32ClFN5O5/c1-36-13-14-38-24-17-23-20(26(31-18-30-23)32-19-5-6-22(29)21(28)15-19)16-25(24)39-34(9-3-2-4-10-34)27(35)33-7-11-37-12-8-33/h5-6,15-18H,2-4,7-14H2,1H3,(H,30,31,32)/q+1 |
| InChIKey | SCLJDCDRODYLRI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|