C9H12BN3O2 — CID 90968513
CID 90968513 (PubChem CID 90968513) has the molecular formula C9H12BN3O2 and a molecular weight of 205.03 g/mol.
| Compound Name | CID 90968513 |
|---|---|
| PubChem CID | 90968513 |
| Molecular Formula | C9H12BN3O2 |
| Molecular Weight | 205.03 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | — |
| SMILES | [B]OCc1ccc(CNC(=O)NN)cc1 |
| InChI | InChI=1S/C9H12BN3O2/c10-15-6-8-3-1-7(2-4-8)5-12-9(14)13-11/h1-4H,5-6,11H2,(H2,12,13,14) |
| InChIKey | QGWLCBFDGQNJFT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.03 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|