C21H25N9O — CID 90972951
5-[2-(diaminomethyl)hydrazinyl]-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]naphthalene-2-carboxamide (PubChem CID 90972951) has the molecular formula C21H25N9O and a molecular weight of 419.49 g/mol. Its IUPAC name is 5-[2-(diaminomethyl)hydrazinyl]-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | 5-[2-(diaminomethyl)hydrazinyl]-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 90972951 |
| Molecular Formula | C21H25N9O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 5-[2-(diaminomethyl)hydrazinyl]-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]naphthalene-2-carboxamide |
| SMILES | CC(=NN=C(N)N)c1ccc(NC(=O)c2ccc3c(NNC(N)N)cccc3c2)cc1 |
| InChI | InChI=1S/C21H25N9O/c1-12(27-29-20(22)23)13-5-8-16(9-6-13)26-19(31)15-7-10-17-14(11-15)3-2-4-18(17)28-30-21(24)25/h2-11,21,28,30H,24-25H2,1H3,(H,26,31)(H4,22,23,29) |
| InChIKey | UGJNAQXDCSJREP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 181.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|