C23H31NO5 — CID 90982766
ethane;methyl 3-[4-[(7-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]anilino]-3-oxopropanoate (PubChem CID 90982766) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is ethane;methyl 3-[4-[(7-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]anilino]-3-oxopropanoate.
| Compound Name | ethane;methyl 3-[4-[(7-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 90982766 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | ethane;methyl 3-[4-[(7-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]anilino]-3-oxopropanoate |
| SMILES | CC.CC.COC(=O)CC(=O)Nc1ccc(Oc2ccc(O)c3c2CCC3)cc1 |
| InChI | InChI=1S/C19H19NO5.2C2H6/c1-24-19(23)11-18(22)20-12-5-7-13(8-6-12)25-17-10-9-16(21)14-3-2-4-15(14)17;2*1-2/h5-10,21H,2-4,11H2,1H3,(H,20,22);2*1-2H3 |
| InChIKey | DVSCMTAQHNLFKF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|