C13H11F15O2 — CID 90992053
8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene (PubChem CID 90992053) has the molecular formula C13H11F15O2 and a molecular weight of 484.20 g/mol. Its IUPAC name is 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene.
| Compound Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene |
|---|---|
| PubChem CID | 90992053 |
| Molecular Formula | C13H11F15O2 |
| Molecular Weight | 484.20 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene |
| SMILES | C=COC.C=COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15O.C3H6O/c1-2-26-3-4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)25;1-3-4-2/h2H,1,3H2;3H,1H2,2H3 |
| InChIKey | GEBFTYQSLFFUKL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.20 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|