C31H50 — CID 91000201
1-(6,6-dimethylhept-1-en-2-yl)-4-[2-(3,6-dimethyl-4-methylidenecycloheptylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 91000201) has the molecular formula C31H50 and a molecular weight of 422.74 g/mol. Its IUPAC name is 1-(6,6-dimethylhept-1-en-2-yl)-4-[2-(3,6-dimethyl-4-methylidenecycloheptylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | 1-(6,6-dimethylhept-1-en-2-yl)-4-[2-(3,6-dimethyl-4-methylidenecycloheptylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 91000201 |
| Molecular Formula | C31H50 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | 1-(6,6-dimethylhept-1-en-2-yl)-4-[2-(3,6-dimethyl-4-methylidenecycloheptylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CC(C)CC(=CC=C2CCCC3(C)C(C(=C)CCCC(C)(C)C)CCC23)CC1C |
| InChI | InChI=1S/C31H50/c1-22-19-24(3)25(4)21-26(20-22)13-14-27-12-10-18-31(8)28(15-16-29(27)31)23(2)11-9-17-30(5,6)7/h13-14,22,25,28-29H,2-3,9-12,15-21H2,1,4-8H3 |
| InChIKey | YIHBYXQFKLJDTP-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|