C24H48O7Si — CID 91006613
(3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5S)-4-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-3-ol (PubChem CID 91006613) has the molecular formula C24H48O7Si and a molecular weight of 476.73 g/mol. Its IUPAC name is (3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5S)-4-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-3-ol.
| Compound Name | (3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5S)-4-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 91006613 |
| Molecular Formula | C24H48O7Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | (3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5S)-4-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-3-ol |
| SMILES | COCC1O[C@@H](OCC2O[C@@H](C)C(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)C(C)[C@@H](OC)[C@@H]1C |
| InChI | InChI=1S/C24H48O7Si/c1-14-17(4)29-19(20(25)22(14)31-32(10,11)24(5,6)7)13-28-23-16(3)21(27-9)15(2)18(30-23)12-26-8/h14-23,25H,12-13H2,1-11H3/t14?,15-,16?,17+,18?,19?,20-,21+,22-,23-/m1/s1 |
| InChIKey | FAZLEGYEZHFPRQ-FWRVJBLHSA-N |
| XLogP | 3.84 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|