C20H34Cl4O3S — CID 91009982
(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)benzene;chloroform;sulfurochloridic acid (PubChem CID 91009982) has the molecular formula C20H34Cl4O3S and a molecular weight of 496.37 g/mol. Its IUPAC name is (3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)benzene;chloroform;sulfurochloridic acid.
| Compound Name | (3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)benzene;chloroform;sulfurochloridic acid |
|---|---|
| PubChem CID | 91009982 |
| Molecular Formula | C20H34Cl4O3S |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)benzene;chloroform;sulfurochloridic acid |
| SMILES | CC(C)(C)C(c1ccccc1)(C(C)(C)C)C(C)(C)C.ClC(Cl)Cl.O=S(=O)(O)Cl |
| InChI | InChI=1S/C19H32.CHCl3.ClHO3S/c1-16(2,3)19(17(4,5)6,18(7,8)9)15-13-11-10-12-14-15;2-1(3)4;1-5(2,3)4/h10-14H,1-9H3;1H;(H,2,3,4) |
| InChIKey | VAUCPXXICXZGCK-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|