C15H24N2O2 — CID 91011691
3-(3,4,4a,8a-tetrahydro-2H-quinolin-1-yl)-N-methyl-3-oxopropanamide;ethane (PubChem CID 91011691) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-(3,4,4a,8a-tetrahydro-2H-quinolin-1-yl)-N-methyl-3-oxopropanamide;ethane.
| Compound Name | 3-(3,4,4a,8a-tetrahydro-2H-quinolin-1-yl)-N-methyl-3-oxopropanamide;ethane |
|---|---|
| PubChem CID | 91011691 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3-(3,4,4a,8a-tetrahydro-2H-quinolin-1-yl)-N-methyl-3-oxopropanamide;ethane |
| SMILES | CC.CNC(=O)CC(=O)N1CCCC2C=CC=CC21 |
| InChI | InChI=1S/C13H18N2O2.C2H6/c1-14-12(16)9-13(17)15-8-4-6-10-5-2-3-7-11(10)15;1-2/h2-3,5,7,10-11H,4,6,8-9H2,1H3,(H,14,16);1-2H3 |
| InChIKey | UZEBKKSLQONPET-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|