C16H26O7 — CID 91012340
2-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)ethyl acetate (PubChem CID 91012340) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)ethyl acetate.
| Compound Name | 2-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)ethyl acetate |
|---|---|
| PubChem CID | 91012340 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-(3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl)ethyl acetate |
| SMILES | CCC1OC(CCOC(C)=O)C(OC(C)=O)C(OC(C)=O)C1C |
| InChI | InChI=1S/C16H26O7/c1-6-13-9(2)15(21-11(4)18)16(22-12(5)19)14(23-13)7-8-20-10(3)17/h9,13-16H,6-8H2,1-5H3 |
| InChIKey | QVWYGINMPWKNKX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|