C24H21Cl2NO2 — CID 91017634
(2,5-dichlorophenyl) 3-phenoxy-N-(4-propan-2-ylphenyl)prop-2-enimidate (PubChem CID 91017634) has the molecular formula C24H21Cl2NO2 and a molecular weight of 426.34 g/mol. Its IUPAC name is (2,5-dichlorophenyl) 3-phenoxy-N-(4-propan-2-ylphenyl)prop-2-enimidate.
| Compound Name | (2,5-dichlorophenyl) 3-phenoxy-N-(4-propan-2-ylphenyl)prop-2-enimidate |
|---|---|
| PubChem CID | 91017634 |
| Molecular Formula | C24H21Cl2NO2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | (2,5-dichlorophenyl) 3-phenoxy-N-(4-propan-2-ylphenyl)prop-2-enimidate |
| SMILES | CC(C)c1ccc(/N=C(\C=COc2ccccc2)Oc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H21Cl2NO2/c1-17(2)18-8-11-20(12-9-18)27-24(14-15-28-21-6-4-3-5-7-21)29-23-16-19(25)10-13-22(23)26/h3-17H,1-2H3/b15-14?,27-24+ |
| InChIKey | YNBPZCXMZUMLQS-DYRXPONOSA-N |
| XLogP | 7.82 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|