C26H28ClFN4O3 — CID 91020170
6-[2-(3-chloro-4-fluorophenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione (PubChem CID 91020170) has the molecular formula C26H28ClFN4O3 and a molecular weight of 498.99 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-fluorophenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-fluorophenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91020170 |
| Molecular Formula | C26H28ClFN4O3 |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 6-[2-(3-chloro-4-fluorophenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(CCc4ccc(F)c(Cl)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C26H28ClFN4O3/c1-15-11-16(2)32-25(29-15)30-23(31-32)13-19-22(33)14-26(35-24(19)34,18-5-3-4-6-18)10-9-17-7-8-21(28)20(27)12-17/h7-8,11-12,18-19H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | OHDSHWKHNPBWLJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|