C21H17F3N4O3 — CID 91021275
N'-(pyridin-4-ylmethyl)-2-[3-[4-(trifluoromethoxy)phenoxy]phenyl]iminoacetohydrazide (PubChem CID 91021275) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is N'-(pyridin-4-ylmethyl)-2-[3-[4-(trifluoromethoxy)phenoxy]phenyl]iminoacetohydrazide.
| Compound Name | N'-(pyridin-4-ylmethyl)-2-[3-[4-(trifluoromethoxy)phenoxy]phenyl]iminoacetohydrazide |
|---|---|
| PubChem CID | 91021275 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N'-(pyridin-4-ylmethyl)-2-[3-[4-(trifluoromethoxy)phenoxy]phenyl]iminoacetohydrazide |
| SMILES | O=C(/C=N/c1cccc(Oc2ccc(OC(F)(F)F)cc2)c1)NNCc1ccncc1 |
| InChI | InChI=1S/C21H17F3N4O3/c22-21(23,24)31-18-6-4-17(5-7-18)30-19-3-1-2-16(12-19)26-14-20(29)28-27-13-15-8-10-25-11-9-15/h1-12,14,27H,13H2,(H,28,29)/b26-14+ |
| InChIKey | HMEWRFGGYRWFAG-VULFUBBASA-N |
| XLogP | 4.30 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|