C24H48 — CID 91024496
7-butyl-3,6,6,7,10,10-hexamethyltetradec-1-ene (PubChem CID 91024496) has the molecular formula C24H48 and a molecular weight of 336.65 g/mol. Its IUPAC name is 7-butyl-3,6,6,7,10,10-hexamethyltetradec-1-ene.
| Compound Name | 7-butyl-3,6,6,7,10,10-hexamethyltetradec-1-ene |
|---|---|
| PubChem CID | 91024496 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 7-butyl-3,6,6,7,10,10-hexamethyltetradec-1-ene |
| SMILES | C=CC(C)CCC(C)(C)C(C)(CCCC)CCC(C)(C)CCCC |
| InChI | InChI=1S/C24H48/c1-10-13-16-22(5,6)19-20-24(9,17-14-11-2)23(7,8)18-15-21(4)12-3/h12,21H,3,10-11,13-20H2,1-2,4-9H3 |
| InChIKey | VIKCAUKPAXGQNE-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|