C7H7NO2 — CID 91041967
2-hydroxy-3H-1,2-benzoxazole (PubChem CID 91041967) has the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. Its IUPAC name is 2-hydroxy-3H-1,2-benzoxazole.
| Compound Name | 2-hydroxy-3H-1,2-benzoxazole |
|---|---|
| PubChem CID | 91041967 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 2-hydroxy-3H-1,2-benzoxazole |
| SMILES | ON1Cc2ccccc2O1 |
| InChI | InChI=1S/C7H7NO2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4,9H,5H2 |
| InChIKey | CCQULCVIHUJHEE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |