C28H36O5 — CID 91042998
methyl 2-[6-ethyl-3,5-bis(phenylmethoxy)-2-prop-2-enyloxan-2-yl]propanoate (PubChem CID 91042998) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is methyl 2-[6-ethyl-3,5-bis(phenylmethoxy)-2-prop-2-enyloxan-2-yl]propanoate.
| Compound Name | methyl 2-[6-ethyl-3,5-bis(phenylmethoxy)-2-prop-2-enyloxan-2-yl]propanoate |
|---|---|
| PubChem CID | 91042998 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | methyl 2-[6-ethyl-3,5-bis(phenylmethoxy)-2-prop-2-enyloxan-2-yl]propanoate |
| SMILES | C=CCC1(C(C)C(=O)OC)OC(CC)C(OCc2ccccc2)CC1OCc1ccccc1 |
| InChI | InChI=1S/C28H36O5/c1-5-17-28(21(3)27(29)30-4)26(32-20-23-15-11-8-12-16-23)18-25(24(6-2)33-28)31-19-22-13-9-7-10-14-22/h5,7-16,21,24-26H,1,6,17-20H2,2-4H3 |
| InChIKey | FDEHRDNRHCAUNR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|