C16H10ClF3N2O4 — CID 91048201
7-chloro-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 91048201) has the molecular formula C16H10ClF3N2O4 and a molecular weight of 386.71 g/mol. Its IUPAC name is 7-chloro-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-chloro-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 91048201 |
| Molecular Formula | C16H10ClF3N2O4 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 7-chloro-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | O=[N+]([O-])c1cc(Cl)c2c(O)n(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C16H10ClF3N2O4/c17-13-6-11(22(24)25)5-10-8-21(15(23)14(10)13)7-9-1-3-12(4-2-9)26-16(18,19)20/h1-6,8,23H,7H2 |
| InChIKey | QXQPDSSIBNCRAQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|