C19H25ClN2O2 — CID 91048962
N-[[(5S)-3-chloro-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide (PubChem CID 91048962) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is N-[[(5S)-3-chloro-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[[(5S)-3-chloro-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 91048962 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[[(5S)-3-chloro-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(NCC12C[C@@H]1CN(Cl)C2)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H25ClN2O2/c20-22-11-16-10-18(16,13-22)12-21-17(23)19(24,15-8-4-5-9-15)14-6-2-1-3-7-14/h1-3,6-7,15-16,24H,4-5,8-13H2,(H,21,23)/t16-,18?,19?/m1/s1 |
| InChIKey | QLMAUNPEEXWNPS-IPJUCJBFSA-N |
| XLogP | 2.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|