C30H55F3O8 — CID 91049301
1-[(2-methylpropan-2-yl)oxy]ethyl 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate;3,3,3-trifluoropropyl 2,2-dimethylbutanoate (PubChem CID 91049301) has the molecular formula C30H55F3O8 and a molecular weight of 600.76 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]ethyl 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate;3,3,3-trifluoropropyl 2,2-dimethylbutanoate.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]ethyl 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate;3,3,3-trifluoropropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91049301 |
| Molecular Formula | C30H55F3O8 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]ethyl 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate;3,3,3-trifluoropropyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)OC(C)(C)C.CCC(C)(C)C(=O)OCC1CO1.CCC(C)(C)C(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C12H24O3.C9H15F3O2.C9H16O3/c1-8-12(6,7)10(13)14-9(2)15-11(3,4)5;1-4-8(2,3)7(13)14-6-5-9(10,11)12;1-4-9(2,3)8(10)12-6-7-5-11-7/h9H,8H2,1-7H3;4-6H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | IVXUQFAXSFXCEO-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 100.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|