C16H13ClN2O3 — CID 91051288
methyl 2-(4-amino-2-chlorophenyl)-2-(1,3-benzoxazol-5-yl)acetate (PubChem CID 91051288) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is methyl 2-(4-amino-2-chlorophenyl)-2-(1,3-benzoxazol-5-yl)acetate.
| Compound Name | methyl 2-(4-amino-2-chlorophenyl)-2-(1,3-benzoxazol-5-yl)acetate |
|---|---|
| PubChem CID | 91051288 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | methyl 2-(4-amino-2-chlorophenyl)-2-(1,3-benzoxazol-5-yl)acetate |
| SMILES | COC(=O)C(c1ccc2ocnc2c1)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C16H13ClN2O3/c1-21-16(20)15(11-4-3-10(18)7-12(11)17)9-2-5-14-13(6-9)19-8-22-14/h2-8,15H,18H2,1H3 |
| InChIKey | YNFUEHISZJURLX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|