C24H15Cl2FN2O4 — CID 91251589
2-(1,3-benzoxazol-5-yl)-2-[4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-fluorophenyl]acetic acid (PubChem CID 91251589) has the molecular formula C24H15Cl2FN2O4 and a molecular weight of 485.30 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-5-yl)-2-[4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-fluorophenyl]acetic acid.
| Compound Name | 2-(1,3-benzoxazol-5-yl)-2-[4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 91251589 |
| Molecular Formula | C24H15Cl2FN2O4 |
| Molecular Weight | 485.30 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 2-(1,3-benzoxazol-5-yl)-2-[4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-fluorophenyl]acetic acid |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Nc1ccc(C(C(=O)O)c2ccc3ocnc3c2)c(F)c1 |
| InChI | InChI=1S/C24H15Cl2FN2O4/c25-15-4-1-13(18(26)10-15)3-8-22(30)29-16-5-6-17(19(27)11-16)23(24(31)32)14-2-7-21-20(9-14)28-12-33-21/h1-12,23H,(H,29,30)(H,31,32) |
| InChIKey | VINLIFJINXWRBO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.30 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|