C16H27FNO6P — CID 91052235
(2,5-dihydroxypyrrol-1-yl) 10-[ethoxy(fluoro)phosphoryl]decanoate (PubChem CID 91052235) has the molecular formula C16H27FNO6P and a molecular weight of 379.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 10-[ethoxy(fluoro)phosphoryl]decanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 10-[ethoxy(fluoro)phosphoryl]decanoate |
|---|---|
| PubChem CID | 91052235 |
| Molecular Formula | C16H27FNO6P |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 10-[ethoxy(fluoro)phosphoryl]decanoate |
| SMILES | CCOP(=O)(F)CCCCCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H27FNO6P/c1-2-23-25(17,22)13-9-7-5-3-4-6-8-10-16(21)24-18-14(19)11-12-15(18)20/h11-12,19-20H,2-10,13H2,1H3 |
| InChIKey | OYQZZBIZTTYXPD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|