C23H30N6O3 — CID 91053387
13-(ethylamino)-8-[[1-(furan-2-carbonyl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 91053387) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 13-(ethylamino)-8-[[1-(furan-2-carbonyl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | 13-(ethylamino)-8-[[1-(furan-2-carbonyl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 91053387 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 13-(ethylamino)-8-[[1-(furan-2-carbonyl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCCC1CN(CC1CCN(C(=O)c3ccco3)CC1)C2=O |
| InChI | InChI=1S/C23H30N6O3/c1-2-24-23-25-13-18-20(26-23)29-9-3-5-17(29)15-28(21(18)30)14-16-7-10-27(11-8-16)22(31)19-6-4-12-32-19/h4,6,12-13,16-17H,2-3,5,7-11,14-15H2,1H3,(H,24,25,26) |
| InChIKey | OCJAUKWAJYBSMX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |