C13H21NO5 — CID 91056222
(2,5-dihydroxypyrrol-1-yl) 6-methoxy-2-methylheptanoate (PubChem CID 91056222) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-methoxy-2-methylheptanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-methoxy-2-methylheptanoate |
|---|---|
| PubChem CID | 91056222 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-methoxy-2-methylheptanoate |
| SMILES | COC(C)CCCC(C)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C13H21NO5/c1-9(5-4-6-10(2)18-3)13(17)19-14-11(15)7-8-12(14)16/h7-10,15-16H,4-6H2,1-3H3 |
| InChIKey | RDBAOGKUKYFUBC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |