C52H64N10O8S2 — CID 91098135
bis[2-[[5-[4-[5-(dimethylamino)pentylcarbamoylamino]phenyl]-1,3,4-oxadiazol-2-yl]-ethylsulfanylmethyl]phenyl] oxalate (PubChem CID 91098135) has the molecular formula C52H64N10O8S2 and a molecular weight of 1021.28 g/mol. Its IUPAC name is bis[2-[[5-[4-[5-(dimethylamino)pentylcarbamoylamino]phenyl]-1,3,4-oxadiazol-2-yl]-ethylsulfanylmethyl]phenyl] oxalate.
| Compound Name | bis[2-[[5-[4-[5-(dimethylamino)pentylcarbamoylamino]phenyl]-1,3,4-oxadiazol-2-yl]-ethylsulfanylmethyl]phenyl] oxalate |
|---|---|
| PubChem CID | 91098135 |
| Molecular Formula | C52H64N10O8S2 |
| Molecular Weight | 1021.28 g/mol |
| Exact Mass | 1020.44 |
| IUPAC Name | bis[2-[[5-[4-[5-(dimethylamino)pentylcarbamoylamino]phenyl]-1,3,4-oxadiazol-2-yl]-ethylsulfanylmethyl]phenyl] oxalate |
| SMILES | CCSC(c1nnc(-c2ccc(NC(=O)NCCCCCN(C)C)cc2)o1)c1ccccc1OC(=O)C(=O)Oc1ccccc1C(SCC)c1nnc(-c2ccc(NC(=O)NCCCCCN(C)C)cc2)o1 |
| InChI | InChI=1S/C52H64N10O8S2/c1-7-71-43(47-59-57-45(69-47)35-23-27-37(28-24-35)55-51(65)53-31-15-9-17-33-61(3)4)39-19-11-13-21-41(39)67-49(63)50(64)68-42-22-14-12-20-40(42)44(72-8-2)48-60-58-46(70-48)36-25-29-38(30-26-36)56-52(66)54-32-16-10-18-34-62(5)6/h11-14,19-30,43-44H,7-10,15-18,31-34H2,1-6H3,(H2,53,55,65)(H2,54,56,66) |
| InChIKey | UCDANDUQNAXCTG-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 219.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.28 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|