C31H30N2O9 — CID 91101814
(4S,4aR,5S,5aR,6R,12aS)-9-(1-benzofuran-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-N,6-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91101814) has the molecular formula C31H30N2O9 and a molecular weight of 574.59 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aS)-9-(1-benzofuran-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-N,6-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aS)-9-(1-benzofuran-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-N,6-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91101814 |
| Molecular Formula | C31H30N2O9 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aS)-9-(1-benzofuran-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-N,6-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CNC(=O)C1C(=O)[C@@H](N(C)C)[C@@H]2[C@@H](O)[C@H]3C(C(=O)c4c(ccc(-c5cc6ccccc6o5)c4O)[C@@H]3C)C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C31H30N2O9/c1-12-14-9-10-15(17-11-13-7-5-6-8-16(13)42-17)24(34)19(14)25(35)20-18(12)26(36)22-23(33(3)4)27(37)21(30(40)32-2)29(39)31(22,41)28(20)38/h5-12,18,20-23,26,34,36,41H,1-4H3,(H,32,40)/t12-,18+,20?,21?,22+,23-,26-,31-/m0/s1 |
| InChIKey | YRFQYKHAEULDGO-OLVIRXNPSA-N |
| XLogP | 1.07 |
| TPSA | 174.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|