C24H21FN8O3 — CID 91107110
(4-fluorophenyl)-[1-[5-nitro-6-[N-(triazol-1-yl)anilino]pyrimidin-4-yl]piperidin-4-yl]methanone (PubChem CID 91107110) has the molecular formula C24H21FN8O3 and a molecular weight of 488.48 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[5-nitro-6-[N-(triazol-1-yl)anilino]pyrimidin-4-yl]piperidin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-[5-nitro-6-[N-(triazol-1-yl)anilino]pyrimidin-4-yl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 91107110 |
| Molecular Formula | C24H21FN8O3 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (4-fluorophenyl)-[1-[5-nitro-6-[N-(triazol-1-yl)anilino]pyrimidin-4-yl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(c2ncnc(N(c3ccccc3)n3ccnn3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H21FN8O3/c25-19-8-6-17(7-9-19)22(34)18-10-13-30(14-11-18)23-21(33(35)36)24(27-16-26-23)32(31-15-12-28-29-31)20-4-2-1-3-5-20/h1-9,12,15-16,18H,10-11,13-14H2 |
| InChIKey | RZURQKOWXUQXMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|