C12H8F2N2S — CID 91107989
3-(3,5-difluorophenyl)-1H-2,1,3-benzothiadiazole (PubChem CID 91107989) has the molecular formula C12H8F2N2S and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1H-2,1,3-benzothiadiazole.
| Compound Name | 3-(3,5-difluorophenyl)-1H-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 91107989 |
| Molecular Formula | C12H8F2N2S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1H-2,1,3-benzothiadiazole |
| SMILES | Fc1cc(F)cc(N2SNc3ccccc32)c1 |
| InChI | InChI=1S/C12H8F2N2S/c13-8-5-9(14)7-10(6-8)16-12-4-2-1-3-11(12)15-17-16/h1-7,15H |
| InChIKey | WXPXKJABAWTDSX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|