C38H35N2O8P — CID 91136210
6-[1,4-bis(4-nitrophenoxy)-4a,8a-dihydronaphthalen-2-yl]benzo[c][2,1]benzoxaphosphinine 6-oxide;ethane (PubChem CID 91136210) has the molecular formula C38H35N2O8P and a molecular weight of 678.68 g/mol. Its IUPAC name is 6-[1,4-bis(4-nitrophenoxy)-4a,8a-dihydronaphthalen-2-yl]benzo[c][2,1]benzoxaphosphinine 6-oxide;ethane.
| Compound Name | 6-[1,4-bis(4-nitrophenoxy)-4a,8a-dihydronaphthalen-2-yl]benzo[c][2,1]benzoxaphosphinine 6-oxide;ethane |
|---|---|
| PubChem CID | 91136210 |
| Molecular Formula | C38H35N2O8P |
| Molecular Weight | 678.68 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | 6-[1,4-bis(4-nitrophenoxy)-4a,8a-dihydronaphthalen-2-yl]benzo[c][2,1]benzoxaphosphinine 6-oxide;ethane |
| SMILES | CC.CC.O=[N+]([O-])c1ccc(OC2=CC(P3(=O)Oc4ccccc4-c4ccccc43)=C(Oc3ccc([N+](=O)[O-])cc3)C3C=CC=CC23)cc1 |
| InChI | InChI=1S/C34H23N2O8P.2C2H6/c37-35(38)22-13-17-24(18-14-22)42-31-21-33(45(41)32-12-6-4-9-28(32)26-7-3-5-11-30(26)44-45)34(29-10-2-1-8-27(29)31)43-25-19-15-23(16-20-25)36(39)40;2*1-2/h1-21,27,29H;2*1-2H3 |
| InChIKey | RGYMTGANOYZRDG-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.68 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|