C22H42N2 — CID 91142071
ethane;1,2,9,10-tetrahydro-1,10-phenanthroline (PubChem CID 91142071) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is ethane;1,2,9,10-tetrahydro-1,10-phenanthroline.
| Compound Name | ethane;1,2,9,10-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 91142071 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | ethane;1,2,9,10-tetrahydro-1,10-phenanthroline |
| SMILES | C1=Cc2ccc3c(c2NC1)NCC=C3.CC.CC.CC.CC.CC |
| InChI | InChI=1S/C12H12N2.5C2H6/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;5*1-2/h1-6,13-14H,7-8H2;5*1-2H3 |
| InChIKey | OBJZCQVUKJYNTF-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |