C25H31F4N5O4 — CID 91147909
2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-(morpholin-4-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 91147909) has the molecular formula C25H31F4N5O4 and a molecular weight of 541.55 g/mol. Its IUPAC name is 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-(morpholin-4-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-(morpholin-4-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 91147909 |
| Molecular Formula | C25H31F4N5O4 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-(morpholin-4-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(c1ccc(CN2CCOCC2)c(F)c1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C25H31F4N5O4/c1-14(2)17-10-18(21(36)11-20(17)35)22(30)34(23(31)24(37)32-13-25(27,28)29)16-4-3-15(19(26)9-16)12-33-5-7-38-8-6-33/h3-4,9-11,14,22,31,35-36H,5-8,12-13,30H2,1-2H3,(H,32,37)/b31-23+ |
| InChIKey | LTKYNJFUYCCXPQ-UQRQXUALSA-N |
| XLogP | 3.31 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|