C10H10N2O4 — CID 91155555
N-(2,2-dihydroxy-3-oxo-1H-indol-5-yl)acetamide (PubChem CID 91155555) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is N-(2,2-dihydroxy-3-oxo-1H-indol-5-yl)acetamide.
| Compound Name | N-(2,2-dihydroxy-3-oxo-1H-indol-5-yl)acetamide |
|---|---|
| PubChem CID | 91155555 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-(2,2-dihydroxy-3-oxo-1H-indol-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)C(O)(O)N2 |
| InChI | InChI=1S/C10H10N2O4/c1-5(13)11-6-2-3-8-7(4-6)9(14)10(15,16)12-8/h2-4,12,15-16H,1H3,(H,11,13) |
| InChIKey | FBNXIPGRDYYMCO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|