C52H68F2O4 — CID 91159285
[4-[4-(3,5-difluoro-4-methylphenyl)butyl]phenyl] 4-(pentylperoxymethyl)cyclohexane-1-carboxylate;1-(4-methylcyclohexyl)-4-(4-propylphenyl)benzene (PubChem CID 91159285) has the molecular formula C52H68F2O4 and a molecular weight of 795.11 g/mol. Its IUPAC name is [4-[4-(3,5-difluoro-4-methylphenyl)butyl]phenyl] 4-(pentylperoxymethyl)cyclohexane-1-carboxylate;1-(4-methylcyclohexyl)-4-(4-propylphenyl)benzene.
| Compound Name | [4-[4-(3,5-difluoro-4-methylphenyl)butyl]phenyl] 4-(pentylperoxymethyl)cyclohexane-1-carboxylate;1-(4-methylcyclohexyl)-4-(4-propylphenyl)benzene |
|---|---|
| PubChem CID | 91159285 |
| Molecular Formula | C52H68F2O4 |
| Molecular Weight | 795.11 g/mol |
| Exact Mass | 794.51 |
| IUPAC Name | [4-[4-(3,5-difluoro-4-methylphenyl)butyl]phenyl] 4-(pentylperoxymethyl)cyclohexane-1-carboxylate;1-(4-methylcyclohexyl)-4-(4-propylphenyl)benzene |
| SMILES | CCCCCOOCC1CCC(C(=O)Oc2ccc(CCCCc3cc(F)c(C)c(F)c3)cc2)CC1.CCCc1ccc(-c2ccc(C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H40F2O4.C22H28/c1-3-4-7-18-34-35-21-24-10-14-26(15-11-24)30(33)36-27-16-12-23(13-17-27)8-5-6-9-25-19-28(31)22(2)29(32)20-25;1-3-4-18-7-11-20(12-8-18)22-15-13-21(14-16-22)19-9-5-17(2)6-10-19/h12-13,16-17,19-20,24,26H,3-11,14-15,18,21H2,1-2H3;7-8,11-17,19H,3-6,9-10H2,1-2H3 |
| InChIKey | MLSPLCPQSCOZOG-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.11 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|