About 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene
4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene (PubChem CID 91165075) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene.
Analyze 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
The IUPAC name of 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene (CID 91165075) is 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene.
What is the SMILES notation for 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
The canonical SMILES for 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene is CC(C)c1cc2c([nH]1)C1CCC2C1.
What is the InChIKey of 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
The InChIKey is HCCRYFWOSMTLFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-7(2)11-6-10-8-3-4-9(5-8)12(10)13-11/h6-9,13H,3-5H2,1-2H3.
What are the key properties of 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene has a molecular weight of 175.28 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene is sourced from PubChem (CID 91165075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).