C14H19BrO2 — CID 91179603
bromomethane;4,7-dimethylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] (PubChem CID 91179603) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is bromomethane;4,7-dimethylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane].
| Compound Name | bromomethane;4,7-dimethylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 91179603 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | bromomethane;4,7-dimethylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
| SMILES | CBr.Cc1ccc(C)c2c1CCC21OCCO1 |
| InChI | InChI=1S/C13H16O2.CH3Br/c1-9-3-4-10(2)12-11(9)5-6-13(12)14-7-8-15-13;1-2/h3-4H,5-8H2,1-2H3;1H3 |
| InChIKey | ULLMHGSIBSTYPU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|